CAS 1067228-90-3 appears in our catalog under these names: 4-Chloro-2,6-dimethoxy phenylboronic acid, 95%, (4–Chloro–2,6–dimethoxyphenyl)boronic acid, (4-Chloro-2,6-dimethoxyphenyl)boronic acid 97%, (4-Chloro-2,6-dimethoxyphenyl)boronic acid, 97%, 97%, (4-Chloro-2,6-dimethoxyphenyl)boronic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg, 100mg, 5g, 10g.
(4-chloro-2,6-dimethoxyphenyl)boronic acid (CAS 1067228-90-3) is a chemical compound with the molecular formula C8H10BClO4 and a molecular weight of 216.43 g/mol. IUPAC name: (4-chloro-2,6-dimethoxyphenyl)boronic acid. InChIKey: VNYKXENLVGSAOC-UHFFFAOYSA-N.
| Molecular formula | C8H10BClO4 |
|---|---|
| Molecular weight | 216.43 g/mol |
| IUPAC name | (4-chloro-2,6-dimethoxyphenyl)boronic acid |
| InChIKey | VNYKXENLVGSAOC-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1OC)Cl)OC)(O)O |
Computed by PubChem (NCBI)