cas: 90381-07-0 — see every product listed under this CAS number, including other names
5-Chloro-2-(trifluoromethyl)benzaldehyde 98% (CAS 90381-07-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A141980-5g |
| cas | 90381-07-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 10g | 381.50 Pln | |
| Ambeed | 25g | 604.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A141980 |
5-chloro-2-(trifluoromethyl)benzaldehyde (CAS 90381-07-0) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 5-chloro-2-(trifluoromethyl)benzaldehyde. InChIKey: CVRLMVFONQYBOC-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 5-chloro-2-(trifluoromethyl)benzaldehyde |
| InChIKey | CVRLMVFONQYBOC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C=O)C(F)(F)F |
Computed by PubChem (NCBI)