cas: 90381-07-0 — see every product listed under this CAS number, including other names
Benzaldehyde, 5-chloro-2-(trifluoromethyl)-, 96%, 96% (CAS 90381-07-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MM2-1g |
| cas | 90381-07-0 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 208.40 Pln | |
| Chemat | 10g | 323.60 Pln | |
| Chemat | 25g | 462.80 Pln | |
| Chemat | 250mg | 83.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
5-chloro-2-(trifluoromethyl)benzaldehyde (CAS 90381-07-0) is a chemical compound with the molecular formula C8H4ClF3O and a molecular weight of 208.56 g/mol. IUPAC name: 5-chloro-2-(trifluoromethyl)benzaldehyde. InChIKey: CVRLMVFONQYBOC-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF3O |
|---|---|
| Molecular weight | 208.56 g/mol |
| IUPAC name | 5-chloro-2-(trifluoromethyl)benzaldehyde |
| InChIKey | CVRLMVFONQYBOC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C=O)C(F)(F)F |
Computed by PubChem (NCBI)