5-Chloro-2-formylphenylboronic acid, 95%
cas: 870238-36-1 — see every product listed under this CAS number, including other names
5-Chloro-2-formylphenylboronic acid, 95% (CAS 870238-36-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F236659-250MG |
| cas | 870238-36-1 |
| size | 250mg |
| availability | In Stock UK |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 227.02 Pln | |
| Fluorochem | 10g | 388.42 Pln | |
| Fluorochem | 25g | 737.26 Pln | |
| Fluorochem | 100g | 2543.91 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 231.31 Pln | |
| Ambeed | 25g | 754.19 Pln | |
| Ambeed | 100g | 2506.38 Pln | |
| Ambeed | 500g | 9804.38 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
(5-chloro-2-formylphenyl)boronic acid (CAS 870238-36-1) is a chemical compound with the molecular formula C7H6BClO3 and a molecular weight of 184.39 g/mol. IUPAC name: (5-chloro-2-formylphenyl)boronic acid. InChIKey: LVNPJTSTUBPCMK-UHFFFAOYSA-N.
| Molecular formula | C7H6BClO3 |
|---|---|
| Molecular weight | 184.39 g/mol |
| IUPAC name | (5-chloro-2-formylphenyl)boronic acid |
| InChIKey | LVNPJTSTUBPCMK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Cl)C=O)(O)O |
Computed by PubChem (NCBI)