cas: 64220-40-2 — see every product listed under this CAS number, including other names
5-Chloro-2-methyl-2,3-dihydro-1H-inden-1-one, 98% (CAS 64220-40-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A188879-100mg |
| cas | 64220-40-2 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 577.78 Pln | |
| AmBeed | 250mg | 681.94 Pln | |
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 404.04 Pln | |
| Fluorochem | 1g | 888.25 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-chloro-2-methyl-2,3-dihydroinden-1-one (CAS 64220-40-2) is a chemical compound with the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. IUPAC name: 5-chloro-2-methyl-2,3-dihydroinden-1-one. InChIKey: RNMXBENXOQYACE-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | 5-chloro-2-methyl-2,3-dihydroinden-1-one |
| InChIKey | RNMXBENXOQYACE-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C1=O)C=CC(=C2)Cl |
Computed by PubChem (NCBI)