cas: 25781-92-4 — see every product listed under this CAS number, including other names
5-Chloro-2-nitro-N-phenylaniline, 95% (CAS 25781-92-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F544575-25G |
| cas | 25781-92-4 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 185.37 Pln | |
| Fluorochem | 100g | 560.24 Pln | |
| Fluorochem | 500g | 2184.67 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-chloro-2-nitro-N-phenylaniline (CAS 25781-92-4) is a chemical compound with the molecular formula C12H9ClN2O2 and a molecular weight of 248.66 g/mol. IUPAC name: 5-chloro-2-nitro-N-phenylaniline. InChIKey: FPKHZBVGKMTUHB-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O2 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | 5-chloro-2-nitro-N-phenylaniline |
| InChIKey | FPKHZBVGKMTUHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C=CC(=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)