CAS 129973-73-5 appears in our catalog under these names: 5-Chloro-2-nitrodiphenylamine-d5, 5-Chloro-2-nitro-N-phenylaniline-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 10 mg, 100 mg.
N-(5-chloro-2-nitrophenyl)-2,3,4,5,6-pentadeuterioaniline (CAS 129973-73-5) is a chemical compound with the molecular formula C12H9ClN2O2 and a molecular weight of 253.69 g/mol. IUPAC name: N-(5-chloro-2-nitrophenyl)-2,3,4,5,6-pentadeuterioaniline. InChIKey: FPKHZBVGKMTUHB-RALIUCGRSA-N.
| Molecular formula | C12H9ClN2O2 |
|---|---|
| Molecular weight | 253.69 g/mol |
| IUPAC name | N-(5-chloro-2-nitrophenyl)-2,3,4,5,6-pentadeuterioaniline |
| InChIKey | FPKHZBVGKMTUHB-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NC2=C(C=CC(=C2)Cl)[N+](=O)[O-])[2H])[2H] |
Computed by PubChem (NCBI)