5-Cyano-2-fluorobenzene-1-sulfonyl chloride, 97%
cas: 1101120-80-2 — see every product listed under this CAS number, including other names
5-Cyano-2-fluorobenzene-1-sulfonyl chloride, 97% (CAS 1101120-80-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A361891-250mg |
| cas | 1101120-80-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 1377.19 Pln | |
| Ambeed | 25g | 4636.81 Pln | |
| BLDpharm | 100mg | 214.39 Pln | |
| BLDpharm | 250mg | 247.72 Pln | |
| BLDpharm | 1g | 353.23 Pln | |
| BLDpharm | 5g | 1480.61 Pln | |
| BLDpharm | 25g | 4996.04 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-cyano-2-fluorobenzenesulfonyl chloride (CAS 1101120-80-2) is a chemical compound with the molecular formula C7H3ClFNO2S and a molecular weight of 219.62 g/mol. IUPAC name: 5-cyano-2-fluorobenzenesulfonyl chloride. InChIKey: XLPGJVFDGAPUIH-UHFFFAOYSA-N.
| Molecular formula | C7H3ClFNO2S |
|---|---|
| Molecular weight | 219.62 g/mol |
| IUPAC name | 5-cyano-2-fluorobenzenesulfonyl chloride |
| InChIKey | XLPGJVFDGAPUIH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)