cas: 69075-42-9 — see every product listed under this CAS number, including other names
5-Ethynyluridine, 95% (CAS 69075-42-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 1mg, 10g, 15g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A124323-50mg |
| cas | 69075-42-9 |
| size | 50mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 197.94 Pln | |
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 342.56 Pln | |
| Ambeed | 1g | 820.94 Pln | |
| Ambeed | 5g | 3301.81 Pln | |
| Chemat | 1mg | 88.40 Pln | |
| Chemat | 50mg | 126.80 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 650.00 Pln | |
| Chemat | 5g | 2555.60 Pln | |
| Chemat | 10g | 4950.80 Pln | |
| Chemat | 15g | 7168.40 Pln | |
| Chemat | 25g | 10773.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-ethynyluridine is a terminal acetylenic compound that is uridine substituted by an ethynyl group at position 5. It is a labeling reagent which is used to measure RNA synthesis in proliferating cells. It is a member of uridines and a terminal acetylenic compound.
Source: ChEBI
| Molecular formula | C11H12N2O6 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-ethynylpyrimidine-2,4-dione |
| InChIKey | QCWBIPKYTBFWHH-FDDDBJFASA-N |
| SMILES | C#CC1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O |
Computed by PubChem (NCBI)