CAS 698985-06-7 is the registry number for Methyl 4-[(2-methoxy-2-oxoethyl)amino]-3-nitrobenzoate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g, 25g.
Methyl 4-[(2-methoxy-2-oxoethyl)amino]-3-nitrobenzoate (CAS 698985-06-7) is a chemical compound with the molecular formula C11H12N2O6 and a molecular weight of 268.22 g/mol. IUPAC name: methyl 4-[(2-methoxy-2-oxoethyl)amino]-3-nitrobenzoate. InChIKey: WABUYJXRDJWTKO-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O6 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | methyl 4-[(2-methoxy-2-oxoethyl)amino]-3-nitrobenzoate |
| InChIKey | WABUYJXRDJWTKO-UHFFFAOYSA-N |
| SMILES | COC(=O)CNC1=C(C=C(C=C1)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)