CAS 13948-21-5 is the registry number for 3-Nitro-n-acetyl-L-tyrosine. Offered by: TRC. Available pack sizes: 500mg.
(2S)-2-acetamido-3-(4-hydroxy-3-nitrophenyl)propanoic acid (CAS 13948-21-5) is a chemical compound with the molecular formula C11H12N2O6 and a molecular weight of 268.22 g/mol. IUPAC name: (2S)-2-acetamido-3-(4-hydroxy-3-nitrophenyl)propanoic acid. InChIKey: MYWCKMXQJXDPQZ-QMMMGPOBSA-N.
| Molecular formula | C11H12N2O6 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | (2S)-2-acetamido-3-(4-hydroxy-3-nitrophenyl)propanoic acid |
| InChIKey | MYWCKMXQJXDPQZ-QMMMGPOBSA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC(=C(C=C1)O)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)