CAS 67688-82-8 appears in our catalog under these names: 4-tert-Butyl-3,5-dinitrobenzoic acid, 95%, 4-(tert-Butyl)-3,5-dinitrobenzoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
4-tert-butyl-3,5-dinitrobenzoic acid (CAS 67688-82-8) is a chemical compound with the molecular formula C11H12N2O6 and a molecular weight of 268.22 g/mol. IUPAC name: 4-tert-butyl-3,5-dinitrobenzoic acid. InChIKey: WHTXLZQPQJAELS-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O6 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | 4-tert-butyl-3,5-dinitrobenzoic acid |
| InChIKey | WHTXLZQPQJAELS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=C(C=C1[N+](=O)[O-])C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)