CAS 1042973-63-6 appears in our catalog under these names: Methyl 2-(2,4-dinitrophenyl)-2-methylpropanoate, 98%, methyl 2–(2,4–dinitrophenyl)–2–methylpropanoate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 200mg.
Methyl 2-(2,4-dinitrophenyl)-2-methylpropanoate (CAS 1042973-63-6) is a chemical compound with the molecular formula C11H12N2O6 and a molecular weight of 268.22 g/mol. IUPAC name: methyl 2-(2,4-dinitrophenyl)-2-methylpropanoate. InChIKey: SABQHLZAPIZMJR-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O6 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | methyl 2-(2,4-dinitrophenyl)-2-methylpropanoate |
| InChIKey | SABQHLZAPIZMJR-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)