CAS 1820651-14-6 is the registry number for Dimethyl 2-(3-methyl-5-nitropyridin-2-yl)malonate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 5g, 1g.
Dimethyl 2-(3-methyl-5-nitro-2-pyridinyl)propanedioate (CAS 1820651-14-6) is a chemical compound with the molecular formula C11H12N2O6 and a molecular weight of 268.22 g/mol. IUPAC name: dimethyl 2-(3-methyl-5-nitro-2-pyridinyl)propanedioate. InChIKey: VRVBXUOXQFENEI-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O6 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | dimethyl 2-(3-methyl-5-nitro-2-pyridinyl)propanedioate |
| InChIKey | VRVBXUOXQFENEI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1C(C(=O)OC)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)