Products 5342-97-2
CAS 5342-97-2 appears in our catalog under these names: tert–Butyl 3,5–dinitrobenzoate, 1,1-Dimethylethyl 3,5-dinitrobenzoate, 98%, 98%, tert-Butyl 3,5-dinitrobenzoate, 99.71%, TERT-BUTYL 3,5-DINITROBENZOATE, 98%, 1,1-Dimethylethyl 3,5-dinitrobenzoate, 98%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 10g, 100 mg, 250 mg, 1g, 5g.
Tert-butyl 3,5-dinitrobenzoate (CAS 5342-97-2) is a chemical compound with the molecular formula C11H12N2O6 and a molecular weight of 268.22 g/mol. IUPAC name: tert-butyl 3,5-dinitrobenzoate. InChIKey: JETCTPYQTQUQPA-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O6 |
|---|---|
| Molecular weight | 268.22 g/mol |
| IUPAC name | tert-butyl 3,5-dinitrobenzoate |
| InChIKey | JETCTPYQTQUQPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=CC(=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
1,1-Dimethylethyl 3,5-dinitrobenzoate, tert-butyl 3,5-dinitrobenzoate, 3,5-dinitro-benzoic acid tert-butyl ester, t-butyl 3,5-dinitrobenzoate, Benzoic acid,3,5-dinitro-, 1,1-dimethylethyl ester, Benzoic acid, 3,5-dinitro-, 1,1-dimethylethyl ester, Benzoic acid,5-dinitro-, 1,1-dimethylethyl ester