cas: 875305-87-6 — see every product listed under this CAS number, including other names
5-Fluoro-1H-indole-7-carboxylic acid, 95%+, 95%+ (CAS 875305-87-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IEO2-100mg |
| cas | 875305-87-6 |
| size | 100mg |
| availability | 0.4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 683.60 Pln | |
| Chemat | 250mg | 1029.20 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
5-fluoro-1H-indole-7-carboxylic acid (CAS 875305-87-6) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 5-fluoro-1H-indole-7-carboxylic acid. InChIKey: SXLQIJMLVHUFKL-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 5-fluoro-1H-indole-7-carboxylic acid |
| InChIKey | SXLQIJMLVHUFKL-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C(C=C(C=C21)F)C(=O)O |
Computed by PubChem (NCBI)