cas: 1197231-40-5 — see every product listed under this CAS number, including other names
5-Fluoro-2,3-dihydrobenzofuran-7-carboxylic acid, 97% (CAS 1197231-40-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A560953-1g |
| cas | 1197231-40-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 9040.78 Pln | |
| AmBeed | 5g | 27066.97 Pln | |
| AmBeed | 10g | 32737.18 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-fluoro-2,3-dihydro-1-benzofuran-7-carboxylic acid (CAS 1197231-40-5) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 5-fluoro-2,3-dihydro-1-benzofuran-7-carboxylic acid. InChIKey: FTBRWBNXIVWAKM-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 5-fluoro-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| InChIKey | FTBRWBNXIVWAKM-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2C(=O)O)F |
Computed by PubChem (NCBI)