Products 1427082-83-4
CAS 1427082-83-4 appears in our catalog under these names: 4-Acetyl-3-fluorobenzoic acid, 4-Acetyl-3-fluorobenzoic acid, 98%, 4-Acetyl-3-fluorobenzoic acid 95%, 4-ACETYL-3-FLUOROBENZOIC ACID, 97%, 4-Acetyl-3-fluorobenzoic acid, 95%, 95%. Offered by: Biosynth, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg, 500mg, 25g.
4-acetyl-3-fluorobenzoic acid (CAS 1427082-83-4) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 4-acetyl-3-fluorobenzoic acid. InChIKey: BPEHVKSKTXMKNX-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 4-acetyl-3-fluorobenzoic acid |
| InChIKey | BPEHVKSKTXMKNX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=C(C=C1)C(=O)O)F |
Computed by PubChem (NCBI)