Products 1505662-44-1
CAS 1505662-44-1 appears in our catalog under these names: 3-Acetyl-4-fluorobenzoic acid, 97%, 3-Acetyl-4-fluorobenzoic acid, 98%, 3-Acetyl-4-fluorobenzoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 25g, 100mg.
3-acetyl-4-fluorobenzoic acid (CAS 1505662-44-1) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 3-acetyl-4-fluorobenzoic acid. InChIKey: RDQMOHIQAIRPQX-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 3-acetyl-4-fluorobenzoic acid |
| InChIKey | RDQMOHIQAIRPQX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)C(=O)O)F |
Computed by PubChem (NCBI)