Products 1508190-04-2
CAS 1508190-04-2 appears in our catalog under these names: 3-Acetyl-2-fluorobenzoic acid, 95%, 3-Acetyl-2-fluorobenzoic acid, 98%, 3-Acetyl-2-fluorobenzoic acid, ≥95%, ≥95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 10g.
3-acetyl-2-fluorobenzoic acid (CAS 1508190-04-2) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 3-acetyl-2-fluorobenzoic acid. InChIKey: DVQVDZTXULIVFR-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 3-acetyl-2-fluorobenzoic acid |
| InChIKey | DVQVDZTXULIVFR-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC=C1)C(=O)O)F |
Computed by PubChem (NCBI)
Synonyms:
3-Acetyl-2-fluorobenZoic acid