Products 7761-30-0
CAS 7761-30-0 appears in our catalog under these names: 3-(4-Fluorophenyl)-2-oxopropanoic acid, 95%, 4-Fluoro-a-oxo-benzenepropanoic Acid, >95% (HPLC), 3-(4-Fluorophenyl)-2-oxopropanoic acid, 97%, 3-(4-Fluorophenyl)-2-oxopropanoic acid, 3-(4-Fluorophenyl)-2-oxopropanoic Acid, 97%, 97%. Offered by: Combi-blocks, TRC, AmBeed, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 25mg, 50mg, 100mg, 5g, 0,5g, 500mg.
3-(4-fluorophenyl)-3-oxopropanoic acid (CAS 7761-30-0) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 3-(4-fluorophenyl)-3-oxopropanoic acid. InChIKey: WSWKUJUQMXOEQK-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-3-oxopropanoic acid |
| InChIKey | WSWKUJUQMXOEQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)CC(=O)O)F |
Computed by PubChem (NCBI)