CAS 1197231-40-5 appears in our catalog under these names: 5-Fluoro-2,3-dihydrobenzofuran-7-carboxylic acid, 95%, 5-Fluoro-2,3-dihydrobenzofuran-7-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g.
5-fluoro-2,3-dihydro-1-benzofuran-7-carboxylic acid (CAS 1197231-40-5) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 5-fluoro-2,3-dihydro-1-benzofuran-7-carboxylic acid. InChIKey: FTBRWBNXIVWAKM-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 5-fluoro-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| InChIKey | FTBRWBNXIVWAKM-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2C(=O)O)F |
Computed by PubChem (NCBI)