CAS 306934-87-2 appears in our catalog under these names: 6-Fluoro-4h-1,3-benzodioxine-8-carbaldehyde, 95%, 6-Fluoro-4H-benzo[d][1,3]dioxine-8-carbaldehyde, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g, 10g.
6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde (CAS 306934-87-2) is a chemical compound with the molecular formula C9H7FO3 and a molecular weight of 182.15 g/mol. IUPAC name: 6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde. InChIKey: NUQNWDKKRFXBPK-UHFFFAOYSA-N.
| Molecular formula | C9H7FO3 |
|---|---|
| Molecular weight | 182.15 g/mol |
| IUPAC name | 6-fluoro-4H-1,3-benzodioxine-8-carbaldehyde |
| InChIKey | NUQNWDKKRFXBPK-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)F)C=O)OCO1 |
Computed by PubChem (NCBI)