cas: 239135-48-9 — see every product listed under this CAS number, including other names
5-Fluoro-2-(trifluoromethyl)benzyl bromide (CAS 239135-48-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F007925-1G |
| cas | 239135-48-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 237.43 Pln | |
| Fluorochem | 5g | 518.59 Pln |
| delivery time | 2-3 weeks |
|---|
2-(bromomethyl)-4-fluoro-1-(trifluoromethyl)benzene (CAS 239135-48-9) is a chemical compound with the molecular formula C8H5BrF4 and a molecular weight of 257.02 g/mol. IUPAC name: 2-(bromomethyl)-4-fluoro-1-(trifluoromethyl)benzene. InChIKey: MQZWBTRGSDOAIO-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4 |
|---|---|
| Molecular weight | 257.02 g/mol |
| IUPAC name | 2-(bromomethyl)-4-fluoro-1-(trifluoromethyl)benzene |
| InChIKey | MQZWBTRGSDOAIO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CBr)C(F)(F)F |
Computed by PubChem (NCBI)