cas: 154630-32-7 — see every product listed under this CAS number, including other names
5-Fluoro-benzo[b]thiophene-2-carboxylic acid methyl ester, 96%, 96% (CAS 154630-32-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ACWW-1g |
| cas | 154630-32-7 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 717.20 Pln | |
| Chemat | 5g | 2301.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Methyl 5-fluoro-1-benzothiophene-2-carboxylate (CAS 154630-32-7) is a chemical compound with the molecular formula C10H7FO2S and a molecular weight of 210.23 g/mol. IUPAC name: methyl 5-fluoro-1-benzothiophene-2-carboxylate. InChIKey: KMBHCZSECUMYRF-UHFFFAOYSA-N.
| Molecular formula | C10H7FO2S |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | methyl 5-fluoro-1-benzothiophene-2-carboxylate |
| InChIKey | KMBHCZSECUMYRF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)C=CC(=C2)F |
Computed by PubChem (NCBI)