cas: 154630-32-7 — see every product listed under this CAS number, including other names
Methyl 5-fluorobenzo[b]thiophene-2-carboxylate, 96% (CAS 154630-32-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F240514-100MG |
| cas | 154630-32-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 544.62 Pln | |
| Fluorochem | 1g | 1356.83 Pln | |
| Fluorochem | 5g | 4558.83 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-fluoro-1-benzothiophene-2-carboxylate (CAS 154630-32-7) is a chemical compound with the molecular formula C10H7FO2S and a molecular weight of 210.23 g/mol. IUPAC name: methyl 5-fluoro-1-benzothiophene-2-carboxylate. InChIKey: KMBHCZSECUMYRF-UHFFFAOYSA-N.
| Molecular formula | C10H7FO2S |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | methyl 5-fluoro-1-benzothiophene-2-carboxylate |
| InChIKey | KMBHCZSECUMYRF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)C=CC(=C2)F |
Computed by PubChem (NCBI)