cas: 610-37-7 — see every product listed under this CAS number, including other names
5-Hydroxy-2-nitrobenzoic acid 98% (CAS 610-37-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A131901-250mg |
| cas | 610-37-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 164.56 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 715.25 Pln | |
| Ambeed | 500g | 2645.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A131901 |
5-hydroxy-2-nitrobenzoic acid (CAS 610-37-7) is a chemical compound with the molecular formula C7H5NO5 and a molecular weight of 183.12 g/mol. IUPAC name: 5-hydroxy-2-nitrobenzoic acid. InChIKey: BUHKQTKKZAXSMH-UHFFFAOYSA-N.
| Molecular formula | C7H5NO5 |
|---|---|
| Molecular weight | 183.12 g/mol |
| IUPAC name | 5-hydroxy-2-nitrobenzoic acid |
| InChIKey | BUHKQTKKZAXSMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)