cas: 38469-84-0 — see every product listed under this CAS number, including other names
5-Methoxy-2-Nitrobenzonitrile, 97%, 97% (CAS 38469-84-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYK7-10g |
| cas | 38469-84-0 |
| size | 10g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 318.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 189.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-methoxy-2-nitrobenzonitrile (CAS 38469-84-0) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 5-methoxy-2-nitrobenzonitrile. InChIKey: GCXTYFJQZDWUNU-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 5-methoxy-2-nitrobenzonitrile |
| InChIKey | GCXTYFJQZDWUNU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)