cas: 88751-06-8 — see every product listed under this CAS number, including other names
5-Methylimidazo[1,2-a]pyridine-2-carboxylic acid, 97% (CAS 88751-06-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F077187-1G |
| cas | 88751-06-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 185.37 Pln | |
| Fluorochem | 5g | 685.19 Pln | |
| Fluorochem | 10g | 1247.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-methylimidazo[1,2-a]pyridine-2-carboxylic acid (CAS 88751-06-8) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 5-methylimidazo[1,2-a]pyridine-2-carboxylic acid. InChIKey: ITABKLPNHAGZEG-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 5-methylimidazo[1,2-a]pyridine-2-carboxylic acid |
| InChIKey | ITABKLPNHAGZEG-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC2=NC(=CN12)C(=O)O |
Computed by PubChem (NCBI)