cas: 198348-89-9 — see every product listed under this CAS number, including other names
5-Nitro-1H-pyrazole-3-carboxylic acid, 95% (CAS 198348-89-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F043837-1G |
| cas | 198348-89-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 169.75 Pln | |
| Fluorochem | 10g | 237.43 Pln | |
| Fluorochem | 25g | 513.38 Pln | |
| Fluorochem | 100g | 1872.28 Pln | |
| Fluorochem | 500g | 9109.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-nitro-1H-pyrazole-3-carboxylic acid (CAS 198348-89-9) is a chemical compound with the molecular formula C4H3N3O4 and a molecular weight of 157.08 g/mol. IUPAC name: 5-nitro-1H-pyrazole-3-carboxylic acid. InChIKey: HKYHBMLIEAMWRO-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O4 |
|---|---|
| Molecular weight | 157.08 g/mol |
| IUPAC name | 5-nitro-1H-pyrazole-3-carboxylic acid |
| InChIKey | HKYHBMLIEAMWRO-UHFFFAOYSA-N |
| SMILES | C1=C(NN=C1C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)