cas: 198348-89-9 — see every product listed under this CAS number, including other names
5-Nitro-3-pyrazolecarboxylic acid, 98%, 98% (CAS 198348-89-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113BG6-25g |
| cas | 198348-89-9 |
| size | 25g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 395.60 Pln | |
| Chemat | 100g | 1403.60 Pln | |
| Chemat | 500g | 6825.60 Pln | |
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 10g | 194.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-nitro-1H-pyrazole-3-carboxylic acid (CAS 198348-89-9) is a chemical compound with the molecular formula C4H3N3O4 and a molecular weight of 157.08 g/mol. IUPAC name: 5-nitro-1H-pyrazole-3-carboxylic acid. InChIKey: HKYHBMLIEAMWRO-UHFFFAOYSA-N.
| Molecular formula | C4H3N3O4 |
|---|---|
| Molecular weight | 157.08 g/mol |
| IUPAC name | 5-nitro-1H-pyrazole-3-carboxylic acid |
| InChIKey | HKYHBMLIEAMWRO-UHFFFAOYSA-N |
| SMILES | C1=C(NN=C1C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)