cas: 63707-35-7 — see every product listed under this CAS number, including other names
5-Nitro-2-phenoxybenzonitrile 95+% (CAS 63707-35-7) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A645141-1g |
| cas | 63707-35-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 1538.50 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A645141 |
5-nitro-2-phenoxybenzonitrile (CAS 63707-35-7) is a chemical compound with the molecular formula C13H8N2O3 and a molecular weight of 240.21 g/mol. IUPAC name: 5-nitro-2-phenoxybenzonitrile. InChIKey: FRGNJGLFPJYGLU-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O3 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 5-nitro-2-phenoxybenzonitrile |
| InChIKey | FRGNJGLFPJYGLU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)[N+](=O)[O-])C#N |
Computed by PubChem (NCBI)