cas: 1499162-58-1 — see every product listed under this CAS number, including other names
5-Nitro-6-Ethoxy-1H-Indazole, 95%+, 95%+ (CAS 1499162-58-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112M5E-100mg |
| cas | 1499162-58-1 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 338.00 Pln | |
| Chemat | 250mg | 477.20 Pln | |
| Chemat | 1g | 890.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
6-ethoxy-5-nitro-1H-indazole (CAS 1499162-58-1) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: 6-ethoxy-5-nitro-1H-indazole. InChIKey: QIXSOYWBGCLBKY-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 6-ethoxy-5-nitro-1H-indazole |
| InChIKey | QIXSOYWBGCLBKY-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C2C=NNC2=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)