CAS 230644-88-9 is the registry number for 6-Amino-1-(2-furylmethyl)pyrimidine-2,4(1h,3h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-amino-1-(furan-2-ylmethyl)pyrimidine-2,4-dione (CAS 230644-88-9) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: 6-amino-1-(furan-2-ylmethyl)pyrimidine-2,4-dione. InChIKey: GHRQDNKXGRCCNU-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 6-amino-1-(furan-2-ylmethyl)pyrimidine-2,4-dione |
| InChIKey | GHRQDNKXGRCCNU-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)CN2C(=CC(=O)NC2=O)N |
Computed by PubChem (NCBI)