CAS 328546-65-2 is the registry number for 9-Nitro-1,2,3,4-tetrahydro-5h-1,4-benzodiazepin-5-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one (CAS 328546-65-2) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one. InChIKey: ZSLHWCFNYIEQJJ-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | 9-nitro-1,2,3,4-tetrahydro-1,4-benzodiazepin-5-one |
| InChIKey | ZSLHWCFNYIEQJJ-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C(N1)C(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)