cas: 6825-25-8 — see every product listed under this CAS number, including other names
5-Nitro-N-phenylpyridin-2-amine 95% (CAS 6825-25-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A642809-1g |
| cas | 6825-25-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 281.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A642809 |
5-nitro-N-phenylpyridin-2-amine (CAS 6825-25-8) is a chemical compound with the molecular formula C11H9N3O2 and a molecular weight of 215.21 g/mol. IUPAC name: 5-nitro-N-phenylpyridin-2-amine. InChIKey: NIPKIXLTWQXXEE-UHFFFAOYSA-N.
| Molecular formula | C11H9N3O2 |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | 5-nitro-N-phenylpyridin-2-amine |
| InChIKey | NIPKIXLTWQXXEE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)