CAS 60768-66-3 is the registry number for 5-Nitrobenzo[d]isothiazole, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-nitro-1,2-benzothiazole (CAS 60768-66-3) is a chemical compound with the molecular formula C7H4N2O2S and a molecular weight of 180.19 g/mol. IUPAC name: 5-nitro-1,2-benzothiazole. InChIKey: AUYJMVMBVRSCMW-UHFFFAOYSA-N.
| Molecular formula | C7H4N2O2S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | 5-nitro-1,2-benzothiazole |
| InChIKey | AUYJMVMBVRSCMW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C=NS2 |
Computed by PubChem (NCBI)