Products 21345-01-7
CAS 21345-01-7 appears in our catalog under these names: 5–Phenoxyisobenzofuran–1，3–dione, 5-Phenoxyisobenzofuran-1,3-dione, 95%, 95%, 5-Phenoxyisobenzofuran-1,3-dione, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
5-phenoxy-2-benzofuran-1,3-dione (CAS 21345-01-7) is a chemical compound with the molecular formula C14H8O4 and a molecular weight of 240.21 g/mol. IUPAC name: 5-phenoxy-2-benzofuran-1,3-dione. InChIKey: HDQBHDKNRKRCNH-UHFFFAOYSA-N.
| Molecular formula | C14H8O4 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 5-phenoxy-2-benzofuran-1,3-dione |
| InChIKey | HDQBHDKNRKRCNH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC3=C(C=C2)C(=O)OC3=O |
Computed by PubChem (NCBI)
Synonyms:
5-Phenoxy-2-benzofuran-1,3-dione, 5-Phenoxyisobenzofuran-1,3-dione, 5-Phenoxy-1,3-isobenzofurandione, 4-Phenoxyphthalic anhydride, 5-phenoxy-1,3-dihydro-2-benzofuran-1,3-dione, 4-phenoxy-phthalic acid anhydride, 1,3-Isobenzofurandione, 5-phenoxy-, 4-phenoxy-phthalic acid anhydride ? 5-Phenoxy-2-benzofuran-1,3-dione