CAS 486-58-8 appears in our catalog under these names: Disalicylide, Disalicylide . Offered by: Chemat Brand, Hubei YoungXin, Mikromol. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
Benzo[c][1,5]benzodioxocine-6,12-dione (CAS 486-58-8) is a chemical compound with the molecular formula C14H8O4 and a molecular weight of 240.21 g/mol. IUPAC name: benzo[c][1,5]benzodioxocine-6,12-dione. InChIKey: MLSVGAXOQBMEGH-UHFFFAOYSA-N.
| Molecular formula | C14H8O4 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | benzo[c][1,5]benzodioxocine-6,12-dione |
| InChIKey | MLSVGAXOQBMEGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)OC3=CC=CC=C3C(=O)O2 |
Computed by PubChem (NCBI)