Products 859745-04-3
CAS 859745-04-3 is the registry number for Dibenzofuran 2-Oxoacetic Acid. Offered by: TRC. Available pack sizes: 5g.
2-dibenzofuran-2-yl-2-oxoacetic acid (CAS 859745-04-3) is a chemical compound with the molecular formula C14H8O4 and a molecular weight of 240.21 g/mol. IUPAC name: 2-dibenzofuran-2-yl-2-oxoacetic acid. InChIKey: HMKWDMHCKDMRKD-UHFFFAOYSA-N.
| Molecular formula | C14H8O4 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 2-dibenzofuran-2-yl-2-oxoacetic acid |
| InChIKey | HMKWDMHCKDMRKD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)C(=O)C(=O)O |
Computed by PubChem (NCBI)