CAS 1875054-10-6 appears in our catalog under these names: 9-(Prop-2-yn-1-yloxy)furo[3,2-g]chromen-2-one, 95%, 9-(2-Propyn-1-yloxy)-7H-furo(3,2-g)(1)benzopyran-7-one. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 250mg.
9-prop-2-ynoxyfuro[3,2-g]chromen-7-one (CAS 1875054-10-6) is a chemical compound with the molecular formula C14H8O4 and a molecular weight of 240.21 g/mol. IUPAC name: 9-prop-2-ynoxyfuro[3,2-g]chromen-7-one. InChIKey: LCBGURBZUMTAPB-UHFFFAOYSA-N.
| Molecular formula | C14H8O4 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 9-prop-2-ynoxyfuro[3,2-g]chromen-7-one |
| InChIKey | LCBGURBZUMTAPB-UHFFFAOYSA-N |
| SMILES | C#CCOC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2 |
Computed by PubChem (NCBI)