CAS 4361-00-6 appears in our catalog under these names: 3-Oxo-3h-benzo[f]chromene-2-carboxylic acid, 90%, 3-Oxo-3H-benzo(f)chromene-2-carboxylic acid, 95-<97%, 3-OXO-3H-BENZO[F]CHROMENE-2-CARBOXYLIC ACID, 96%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Chemat. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 50g, 100g.
3-oxobenzo[f]chromene-2-carboxylic acid (CAS 4361-00-6) is a chemical compound with the molecular formula C14H8O4 and a molecular weight of 240.21 g/mol. IUPAC name: 3-oxobenzo[f]chromene-2-carboxylic acid. InChIKey: RMHHFZIWCLXRTA-UHFFFAOYSA-N.
| Molecular formula | C14H8O4 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 3-oxobenzo[f]chromene-2-carboxylic acid |
| InChIKey | RMHHFZIWCLXRTA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC3=C2C=C(C(=O)O3)C(=O)O |
Computed by PubChem (NCBI)