Products 1146-72-1
CAS 1146-72-1 is the registry number for 4-Acetyl-1,8-naphthalic anhydride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
8-acetyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (CAS 1146-72-1) is a chemical compound with the molecular formula C14H8O4 and a molecular weight of 240.21 g/mol. IUPAC name: 8-acetyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione. InChIKey: RGBKEYIMRMDPHI-UHFFFAOYSA-N.
| Molecular formula | C14H8O4 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 8-acetyl-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| InChIKey | RGBKEYIMRMDPHI-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C2C=CC=C3C2=C(C=C1)C(=O)OC3=O |
Computed by PubChem (NCBI)