Products 40274-67-7
CAS 40274-67-7 appears in our catalog under these names: 9-Oxoxanthene-2-carboxylic acid, 95%, 9-Oxo-9H-xanthene-2-carboxylic acid 98%, 9-Oxo-9H-xanthene-2-carboxylic acid, 98%, 98%, 9-Oxoxanthene-2-carboxylic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
9-oxoxanthene-2-carboxylic acid (CAS 40274-67-7) is a chemical compound with the molecular formula C14H8O4 and a molecular weight of 240.21 g/mol. IUPAC name: 9-oxoxanthene-2-carboxylic acid. InChIKey: JNPRWSKMJDGYAN-UHFFFAOYSA-N.
| Molecular formula | C14H8O4 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 9-oxoxanthene-2-carboxylic acid |
| InChIKey | JNPRWSKMJDGYAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(O2)C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)