cas: 185316-58-9 — see every product listed under this CAS number, including other names
5-Phenyl-1H-indazole, 98%, 98% (CAS 185316-58-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I2JP-100mg |
| cas | 185316-58-9 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 520.40 Pln | |
| Chemat | 1g | 1154.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-phenyl-1H-indazole (CAS 185316-58-9) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 5-phenyl-1H-indazole. InChIKey: JQHTYMOOIFVIJV-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 5-phenyl-1H-indazole |
| InChIKey | JQHTYMOOIFVIJV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)NN=C3 |
Computed by PubChem (NCBI)