cas: 14441-90-8 — see every product listed under this CAS number, including other names
5-Phenyl-isoxazole-3-carboxylic acid, 97%, 97% (CAS 14441-90-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112JI5-100mg |
| cas | 14441-90-8 |
| size | 100mg |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 203.60 Pln | |
| Chemat | 25g | 405.20 Pln | |
| Chemat | 100g | 1394.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-phenyl-1,2-oxazole-3-carboxylic acid (CAS 14441-90-8) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 5-phenyl-1,2-oxazole-3-carboxylic acid. InChIKey: XJYOBHXWBRKOQO-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 5-phenyl-1,2-oxazole-3-carboxylic acid |
| InChIKey | XJYOBHXWBRKOQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)