cas: 14441-90-8 — see every product listed under this CAS number, including other names
5-Phenyl-isoxazole-3-carboxylic acid, 97% (CAS 14441-90-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F027909-1G |
| cas | 14441-90-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 289.50 Pln | |
| Fluorochem | 25g | 627.92 Pln | |
| Fluorochem | 100g | 1950.37 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-phenyl-1,2-oxazole-3-carboxylic acid (CAS 14441-90-8) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 5-phenyl-1,2-oxazole-3-carboxylic acid. InChIKey: XJYOBHXWBRKOQO-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 5-phenyl-1,2-oxazole-3-carboxylic acid |
| InChIKey | XJYOBHXWBRKOQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)