5-Phenylisoxazole-3-carboxylic acid, 97%
cas: 14441-90-8 — see every product listed under this CAS number, including other names
5-Phenylisoxazole-3-carboxylic acid, 97% (CAS 14441-90-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 100mg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A114988-250mg |
| cas | 14441-90-8 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 309.19 Pln | |
| Ambeed | 25g | 654.06 Pln | |
| Ambeed | 100g | 1972.38 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 208.84 Pln | |
| BLDpharm | 10g | 325.47 Pln | |
| BLDpharm | 25g | 697.56 Pln | |
| BLDpharm | 100g | 2124.83 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-phenyl-1,2-oxazole-3-carboxylic acid (CAS 14441-90-8) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 5-phenyl-1,2-oxazole-3-carboxylic acid. InChIKey: XJYOBHXWBRKOQO-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 5-phenyl-1,2-oxazole-3-carboxylic acid |
| InChIKey | XJYOBHXWBRKOQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Phenyl-3-isoxazolecarboxylic acid, 5-Phenylisoxazole-3-carboxylic acid, 5-Phenyl-isoxazole-3-carboxylic acid, 5-phenyl-1,2-oxazole-3-carboxylic acid, 3-Isoxazolecarboxylic acid, 5-phenyl-, XJYOBHXWBRKOQO-UHFFFAOYSA-N, 5-phenylisoxazol-3-carboxylic acid, 5-Phenylisoxazole-3-carboxylic acid, 97%