cas: 1036027-54-9 — see every product listed under this CAS number, including other names
5-Trifluoromethyl-1H-pyrrolo[2,3-b]pyridine, 97% (CAS 1036027-54-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076410-1G |
| cas | 1036027-54-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 159.34 Pln | |
| Fluorochem | 5g | 544.62 Pln | |
| Fluorochem | 10g | 1028.82 Pln | |
| Fluorochem | 25g | 2481.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 1036027-54-9) is a chemical compound with the molecular formula C8H5F3N2 and a molecular weight of 186.13 g/mol. IUPAC name: 5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: KHAGHXUTEFDDOD-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2 |
|---|---|
| Molecular weight | 186.13 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | KHAGHXUTEFDDOD-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=C(C=C21)C(F)(F)F |
Computed by PubChem (NCBI)