CAS 1379055-74-9 is the registry number for 6-(2,2,2-Trifluoroethyl)nicotinonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(2,2,2-trifluoroethyl)pyridine-3-carbonitrile (CAS 1379055-74-9) is a chemical compound with the molecular formula C8H5F3N2 and a molecular weight of 186.13 g/mol. IUPAC name: 6-(2,2,2-trifluoroethyl)pyridine-3-carbonitrile. InChIKey: FWYPAWSESYOBQT-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2 |
|---|---|
| Molecular weight | 186.13 g/mol |
| IUPAC name | 6-(2,2,2-trifluoroethyl)pyridine-3-carbonitrile |
| InChIKey | FWYPAWSESYOBQT-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC=C1C#N)CC(F)(F)F |
Computed by PubChem (NCBI)